C11H19N3O — CID 136852206
4-(2,2,3-trimethylbutylamino)-1H-pyrimidin-6-one (PubChem CID 136852206) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 4-(2,2,3-trimethylbutylamino)-1H-pyrimidin-6-one.
| Compound Name | 4-(2,2,3-trimethylbutylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136852206 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 4-(2,2,3-trimethylbutylamino)-1H-pyrimidin-6-one |
| SMILES | CC(C)C(C)(C)CNc1cc(=O)[nH]cn1 |
| InChI | InChI=1S/C11H19N3O/c1-8(2)11(3,4)6-12-9-5-10(15)14-7-13-9/h5,7-8H,6H2,1-4H3,(H2,12,13,14,15) |
| InChIKey | YRDFJIXJCNRULF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |