C18H7F17N2O — CID 136852891
4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-2-phenyl-1H-pyrimidin-6-one (PubChem CID 136852891) has the molecular formula C18H7F17N2O and a molecular weight of 590.23 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-2-phenyl-1H-pyrimidin-6-one.
| Compound Name | 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-2-phenyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136852891 |
| Molecular Formula | C18H7F17N2O |
| Molecular Weight | 590.23 g/mol |
| Exact Mass | 590.03 |
| IUPAC Name | 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-2-phenyl-1H-pyrimidin-6-one |
| SMILES | O=c1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)nc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C18H7F17N2O/c19-11(20,8-6-9(38)37-10(36-8)7-4-2-1-3-5-7)12(21,22)13(23,24)14(25,26)15(27,28)16(29,30)17(31,32)18(33,34)35/h1-6H,(H,36,37,38) |
| InChIKey | KQBHOBBUFLANNC-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.23 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|