C12H7ClF4N2O — CID 136852892
4-(2-chloro-1,1,2,2-tetrafluoroethyl)-2-phenyl-1H-pyrimidin-6-one (PubChem CID 136852892) has the molecular formula C12H7ClF4N2O and a molecular weight of 306.65 g/mol. Its IUPAC name is 4-(2-chloro-1,1,2,2-tetrafluoroethyl)-2-phenyl-1H-pyrimidin-6-one.
| Compound Name | 4-(2-chloro-1,1,2,2-tetrafluoroethyl)-2-phenyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136852892 |
| Molecular Formula | C12H7ClF4N2O |
| Molecular Weight | 306.65 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 4-(2-chloro-1,1,2,2-tetrafluoroethyl)-2-phenyl-1H-pyrimidin-6-one |
| SMILES | O=c1cc(C(F)(F)C(F)(F)Cl)nc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C12H7ClF4N2O/c13-12(16,17)11(14,15)8-6-9(20)19-10(18-8)7-4-2-1-3-5-7/h1-6H,(H,18,19,20) |
| InChIKey | IILQZFSXCYOMGK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.65 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|