About 1-aminobenzotriazole-4,7-diol
1-aminobenzotriazole-4,7-diol (PubChem CID 136852909) has the molecular formula C6H6N4O2
and a molecular weight of 166.14 g/mol. Its IUPAC name is 1-aminobenzotriazole-4,7-diol.
Molecular Properties
| Compound Name | 1-aminobenzotriazole-4,7-diol |
| PubChem CID | 136852909 |
| Molecular Formula | C6H6N4O2 |
| Molecular Weight | 166.14 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 1-aminobenzotriazole-4,7-diol |
| SMILES | Nn1nnc2c(O)ccc(O)c21 |
| InChI | InChI=1S/C6H6N4O2/c7-10-6-4(12)2-1-3(11)5(6)8-9-10/h1-2,11-12H,7H2 |
| InChIKey | UTLPLJVBTJASAO-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.14 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 1-aminobenzotriazole-4,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminobenzotriazole-4,7-diol?
The IUPAC name of 1-aminobenzotriazole-4,7-diol (CID 136852909) is 1-aminobenzotriazole-4,7-diol.
What is the SMILES notation for 1-aminobenzotriazole-4,7-diol?
The canonical SMILES for 1-aminobenzotriazole-4,7-diol is Nn1nnc2c(O)ccc(O)c21.
What is the InChIKey of 1-aminobenzotriazole-4,7-diol?
The InChIKey is UTLPLJVBTJASAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O2/c7-10-6-4(12)2-1-3(11)5(6)8-9-10/h1-2,11-12H,7H2.
What are the key properties of 1-aminobenzotriazole-4,7-diol?
1-aminobenzotriazole-4,7-diol has a molecular weight of 166.14 g/mol, XLogP of -0.44, 0 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminobenzotriazole-4,7-diol is sourced from PubChem (CID 136852909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).