C12H16N4O2 — CID 136854218
(5S,7R)-7-(furan-2-yl)-2-(methoxymethyl)-5-methyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 136854218) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is (5S,7R)-7-(furan-2-yl)-2-(methoxymethyl)-5-methyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | (5S,7R)-7-(furan-2-yl)-2-(methoxymethyl)-5-methyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136854218 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | (5S,7R)-7-(furan-2-yl)-2-(methoxymethyl)-5-methyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | COCc1nc2n(n1)[C@@H](c1ccco1)C[C@H](C)N2 |
| InChI | InChI=1S/C12H16N4O2/c1-8-6-9(10-4-3-5-18-10)16-12(13-8)14-11(15-16)7-17-2/h3-5,8-9H,6-7H2,1-2H3,(H,13,14,15)/t8-,9+/m0/s1 |
| InChIKey | BLLQBITXBZRZDC-DTWKUNHWSA-N |
| XLogP | 1.81 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |