About methyl 3-(4-hydroxyphenyl)-4,5-dihydrobenzo[g]indazole-2-carboxylate
methyl 3-(4-hydroxyphenyl)-4,5-dihydrobenzo[g]indazole-2-carboxylate (PubChem CID 136854413) has the molecular formula C19H16N2O3
and a molecular weight of 320.35 g/mol. Its IUPAC name is methyl 3-(4-hydroxyphenyl)-4,5-dihydrobenzo[g]indazole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-(4-hydroxyphenyl)-4,5-dihydrobenzo[g]indazole-2-carboxylate |
| PubChem CID | 136854413 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | methyl 3-(4-hydroxyphenyl)-4,5-dihydrobenzo[g]indazole-2-carboxylate |
| SMILES | COC(=O)n1nc2c(c1-c1ccc(O)cc1)CCc1ccccc1-2 |
| InChI | InChI=1S/C19H16N2O3/c1-24-19(23)21-18(13-6-9-14(22)10-7-13)16-11-8-12-4-2-3-5-15(12)17(16)20-21/h2-7,9-10,22H,8,11H2,1H3 |
| InChIKey | RRVQVTLGRDCXAV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-(4-hydroxyphenyl)-4,5-dihydrobenzo[g]indazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(4-hydroxyphenyl)-4,5-dihydrobenzo[g]indazole-2-carboxylate?
The IUPAC name of methyl 3-(4-hydroxyphenyl)-4,5-dihydrobenzo[g]indazole-2-carboxylate (CID 136854413) is methyl 3-(4-hydroxyphenyl)-4,5-dihydrobenzo[g]indazole-2-carboxylate.
What is the SMILES notation for methyl 3-(4-hydroxyphenyl)-4,5-dihydrobenzo[g]indazole-2-carboxylate?
The canonical SMILES for methyl 3-(4-hydroxyphenyl)-4,5-dihydrobenzo[g]indazole-2-carboxylate is COC(=O)n1nc2c(c1-c1ccc(O)cc1)CCc1ccccc1-2.
What is the InChIKey of methyl 3-(4-hydroxyphenyl)-4,5-dihydrobenzo[g]indazole-2-carboxylate?
The InChIKey is RRVQVTLGRDCXAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O3/c1-24-19(23)21-18(13-6-9-14(22)10-7-13)16-11-8-12-4-2-3-5-15(12)17(16)20-21/h2-7,9-10,22H,8,11H2,1H3.
What are the key properties of methyl 3-(4-hydroxyphenyl)-4,5-dihydrobenzo[g]indazole-2-carboxylate?
methyl 3-(4-hydroxyphenyl)-4,5-dihydrobenzo[g]indazole-2-carboxylate has a molecular weight of 320.35 g/mol, XLogP of 3.64, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4-hydroxyphenyl)-4,5-dihydrobenzo[g]indazole-2-carboxylate is sourced from PubChem (CID 136854413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).