C18H16N2O — CID 136854592
1-[[2,3,5-trideuterio-4,6-bis(trideuteriomethyl)phenyl]diazenyl]naphthalen-2-ol (PubChem CID 136854592) has the molecular formula C18H16N2O and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-[[2,3,5-trideuterio-4,6-bis(trideuteriomethyl)phenyl]diazenyl]naphthalen-2-ol.
| Compound Name | 1-[[2,3,5-trideuterio-4,6-bis(trideuteriomethyl)phenyl]diazenyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 136854592 |
| Molecular Formula | C18H16N2O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 1-[[2,3,5-trideuterio-4,6-bis(trideuteriomethyl)phenyl]diazenyl]naphthalen-2-ol |
| SMILES | [2H]c1c([2H])c(C([2H])([2H])[2H])c([2H])c(C([2H])([2H])[2H])c1/N=N/c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C18H16N2O/c1-12-7-9-16(13(2)11-12)19-20-18-15-6-4-3-5-14(15)8-10-17(18)21/h3-11,21H,1-2H3/b20-19+/i1D3,2D3,7D,9D,11D |
| InChIKey | JBTHDAVBDKKSRW-KTTQNAJKSA-N |
| XLogP | 5.58 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|