C27H19N3O4 — CID 136856837
(1R,3aS,6aS)-3-(1-hydroxy-3-oxoinden-2-yl)-5-(3-methylphenyl)-1-pyridin-2-yl-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione (PubChem CID 136856837) has the molecular formula C27H19N3O4 and a molecular weight of 449.47 g/mol. Its IUPAC name is (1R,3aS,6aS)-3-(1-hydroxy-3-oxoinden-2-yl)-5-(3-methylphenyl)-1-pyridin-2-yl-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione.
| Compound Name | (1R,3aS,6aS)-3-(1-hydroxy-3-oxoinden-2-yl)-5-(3-methylphenyl)-1-pyridin-2-yl-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 136856837 |
| Molecular Formula | C27H19N3O4 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | (1R,3aS,6aS)-3-(1-hydroxy-3-oxoinden-2-yl)-5-(3-methylphenyl)-1-pyridin-2-yl-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione |
| SMILES | Cc1cccc(N2C(=O)[C@@H]3C(C4=C(O)c5ccccc5C4=O)=N[C@@H](c4ccccn4)[C@H]3C2=O)c1 |
| InChI | InChI=1S/C27H19N3O4/c1-14-7-6-8-15(13-14)30-26(33)19-20(27(30)34)23(29-22(19)18-11-4-5-12-28-18)21-24(31)16-9-2-3-10-17(16)25(21)32/h2-13,19-20,22,31H,1H3/t19-,20-,22-/m0/s1 |
| InChIKey | UFYPHXMFLJVSAC-ONTIZHBOSA-N |
| XLogP | 3.86 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|