About 4-[(2,2-dimethylcyclopropyl)methylamino]-5-iodo-1H-pyrimidin-6-one
4-[(2,2-dimethylcyclopropyl)methylamino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136857208) has the molecular formula C10H14IN3O
and a molecular weight of 319.15 g/mol. Its IUPAC name is 4-[(2,2-dimethylcyclopropyl)methylamino]-5-iodo-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-[(2,2-dimethylcyclopropyl)methylamino]-5-iodo-1H-pyrimidin-6-one |
| PubChem CID | 136857208 |
| Molecular Formula | C10H14IN3O |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 4-[(2,2-dimethylcyclopropyl)methylamino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CC1(C)CC1CNc1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C10H14IN3O/c1-10(2)3-6(10)4-12-8-7(11)9(15)14-5-13-8/h5-6H,3-4H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | OVGDEKLEZOHOJI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,2-dimethylcyclopropyl)methylamino]-5-iodo-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,2-dimethylcyclopropyl)methylamino]-5-iodo-1H-pyrimidin-6-one?
The IUPAC name of 4-[(2,2-dimethylcyclopropyl)methylamino]-5-iodo-1H-pyrimidin-6-one (CID 136857208) is 4-[(2,2-dimethylcyclopropyl)methylamino]-5-iodo-1H-pyrimidin-6-one.
What is the SMILES notation for 4-[(2,2-dimethylcyclopropyl)methylamino]-5-iodo-1H-pyrimidin-6-one?
The canonical SMILES for 4-[(2,2-dimethylcyclopropyl)methylamino]-5-iodo-1H-pyrimidin-6-one is CC1(C)CC1CNc1nc[nH]c(=O)c1I.
What is the InChIKey of 4-[(2,2-dimethylcyclopropyl)methylamino]-5-iodo-1H-pyrimidin-6-one?
The InChIKey is OVGDEKLEZOHOJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14IN3O/c1-10(2)3-6(10)4-12-8-7(11)9(15)14-5-13-8/h5-6H,3-4H2,1-2H3,(H2,12,13,14,15).
What are the key properties of 4-[(2,2-dimethylcyclopropyl)methylamino]-5-iodo-1H-pyrimidin-6-one?
4-[(2,2-dimethylcyclopropyl)methylamino]-5-iodo-1H-pyrimidin-6-one has a molecular weight of 319.15 g/mol, XLogP of 1.83, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,2-dimethylcyclopropyl)methylamino]-5-iodo-1H-pyrimidin-6-one is sourced from PubChem (CID 136857208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).