About 4-[(5-hydroxy-2,2-dimethylpentyl)amino]-5-iodo-1H-pyrimidin-6-one
4-[(5-hydroxy-2,2-dimethylpentyl)amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136857364) has the molecular formula C11H18IN3O2
and a molecular weight of 351.19 g/mol. Its IUPAC name is 4-[(5-hydroxy-2,2-dimethylpentyl)amino]-5-iodo-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-[(5-hydroxy-2,2-dimethylpentyl)amino]-5-iodo-1H-pyrimidin-6-one |
| PubChem CID | 136857364 |
| Molecular Formula | C11H18IN3O2 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 4-[(5-hydroxy-2,2-dimethylpentyl)amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CC(C)(CCCO)CNc1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C11H18IN3O2/c1-11(2,4-3-5-16)6-13-9-8(12)10(17)15-7-14-9/h7,16H,3-6H2,1-2H3,(H2,13,14,15,17) |
| InChIKey | CKURYESUERKHMU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-[(5-hydroxy-2,2-dimethylpentyl)amino]-5-iodo-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-hydroxy-2,2-dimethylpentyl)amino]-5-iodo-1H-pyrimidin-6-one?
The IUPAC name of 4-[(5-hydroxy-2,2-dimethylpentyl)amino]-5-iodo-1H-pyrimidin-6-one (CID 136857364) is 4-[(5-hydroxy-2,2-dimethylpentyl)amino]-5-iodo-1H-pyrimidin-6-one.
What is the SMILES notation for 4-[(5-hydroxy-2,2-dimethylpentyl)amino]-5-iodo-1H-pyrimidin-6-one?
The canonical SMILES for 4-[(5-hydroxy-2,2-dimethylpentyl)amino]-5-iodo-1H-pyrimidin-6-one is CC(C)(CCCO)CNc1nc[nH]c(=O)c1I.
What is the InChIKey of 4-[(5-hydroxy-2,2-dimethylpentyl)amino]-5-iodo-1H-pyrimidin-6-one?
The InChIKey is CKURYESUERKHMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18IN3O2/c1-11(2,4-3-5-16)6-13-9-8(12)10(17)15-7-14-9/h7,16H,3-6H2,1-2H3,(H2,13,14,15,17).
What are the key properties of 4-[(5-hydroxy-2,2-dimethylpentyl)amino]-5-iodo-1H-pyrimidin-6-one?
4-[(5-hydroxy-2,2-dimethylpentyl)amino]-5-iodo-1H-pyrimidin-6-one has a molecular weight of 351.19 g/mol, XLogP of 1.59, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-hydroxy-2,2-dimethylpentyl)amino]-5-iodo-1H-pyrimidin-6-one is sourced from PubChem (CID 136857364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).