C13H22N4O2 — CID 136857374
2-cyclopropyl-4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-1H-pyrimidin-6-one (PubChem CID 136857374) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-cyclopropyl-4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-1H-pyrimidin-6-one.
| Compound Name | 2-cyclopropyl-4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136857374 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 2-cyclopropyl-4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-1H-pyrimidin-6-one |
| SMILES | CN(C)CC(C)(O)CNc1cc(=O)[nH]c(C2CC2)n1 |
| InChI | InChI=1S/C13H22N4O2/c1-13(19,8-17(2)3)7-14-10-6-11(18)16-12(15-10)9-4-5-9/h6,9,19H,4-5,7-8H2,1-3H3,(H2,14,15,16,18) |
| InChIKey | ZYAIGJPHAGXRJY-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |