About ditert-butyl-[(2R,3S)-3-deuteriobutan-2-yl]-methoxysilane
ditert-butyl-[(2R,3S)-3-deuteriobutan-2-yl]-methoxysilane (PubChem CID 136857515) has the molecular formula C13H30OSi
and a molecular weight of 231.47 g/mol. Its IUPAC name is ditert-butyl-[(2R,3S)-3-deuteriobutan-2-yl]-methoxysilane.
Molecular Properties
| Compound Name | ditert-butyl-[(2R,3S)-3-deuteriobutan-2-yl]-methoxysilane |
| PubChem CID | 136857515 |
| Molecular Formula | C13H30OSi |
| Molecular Weight | 231.47 g/mol |
| Exact Mass | 231.21 |
| IUPAC Name | ditert-butyl-[(2R,3S)-3-deuteriobutan-2-yl]-methoxysilane |
| SMILES | [2H][C@@H](C)[C@@H](C)[Si](OC)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H30OSi/c1-10-11(2)15(14-9,12(3,4)5)13(6,7)8/h11H,10H2,1-9H3/t11-/m1/s1/i10D/t10-,11+/m0 |
| InChIKey | UCCCWTQIRIPJLB-UUAQMXOKSA-N |
| XLogP | 4.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl-[(2R,3S)-3-deuteriobutan-2-yl]-methoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl-[(2R,3S)-3-deuteriobutan-2-yl]-methoxysilane?
The IUPAC name of ditert-butyl-[(2R,3S)-3-deuteriobutan-2-yl]-methoxysilane (CID 136857515) is ditert-butyl-[(2R,3S)-3-deuteriobutan-2-yl]-methoxysilane.
What is the SMILES notation for ditert-butyl-[(2R,3S)-3-deuteriobutan-2-yl]-methoxysilane?
The canonical SMILES for ditert-butyl-[(2R,3S)-3-deuteriobutan-2-yl]-methoxysilane is [2H][C@@H](C)[C@@H](C)[Si](OC)(C(C)(C)C)C(C)(C)C.
What is the InChIKey of ditert-butyl-[(2R,3S)-3-deuteriobutan-2-yl]-methoxysilane?
The InChIKey is UCCCWTQIRIPJLB-UUAQMXOKSA-N. The full InChI is InChI=1S/C13H30OSi/c1-10-11(2)15(14-9,12(3,4)5)13(6,7)8/h11H,10H2,1-9H3/t11-/m1/s1/i10D/t10-,11+/m0.
What are the key properties of ditert-butyl-[(2R,3S)-3-deuteriobutan-2-yl]-methoxysilane?
ditert-butyl-[(2R,3S)-3-deuteriobutan-2-yl]-methoxysilane has a molecular weight of 231.47 g/mol, XLogP of 4.98, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl-[(2R,3S)-3-deuteriobutan-2-yl]-methoxysilane is sourced from PubChem (CID 136857515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).