C21H25N5O3 — CID 136859177
(1R,5aS,7S)-7-[(2R)-1-(6-imino-7H-purin-3-yl)propan-2-yl]-3-methyl-1,5a,6,7,8,9-hexahydropyrano[4,3-b]chromen-1-ol (PubChem CID 136859177) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is (1R,5aS,7S)-7-[(2R)-1-(6-imino-7H-purin-3-yl)propan-2-yl]-3-methyl-1,5a,6,7,8,9-hexahydropyrano[4,3-b]chromen-1-ol.
| Compound Name | (1R,5aS,7S)-7-[(2R)-1-(6-imino-7H-purin-3-yl)propan-2-yl]-3-methyl-1,5a,6,7,8,9-hexahydropyrano[4,3-b]chromen-1-ol |
|---|---|
| PubChem CID | 136859177 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | (1R,5aS,7S)-7-[(2R)-1-(6-imino-7H-purin-3-yl)propan-2-yl]-3-methyl-1,5a,6,7,8,9-hexahydropyrano[4,3-b]chromen-1-ol |
| SMILES | [H]/N=c1\ncn(C[C@H](C)[C@H]2CCC3=CC4=C(C=C(C)O[C@H]4O)O[C@H]3C2)c2nc[nH]c12 |
| InChI | InChI=1S/C21H25N5O3/c1-11(8-26-10-25-19(22)18-20(26)24-9-23-18)13-3-4-14-6-15-17(29-16(14)7-13)5-12(2)28-21(15)27/h5-6,9-11,13,16,21-22,27H,3-4,7-8H2,1-2H3,(H,23,24)/b22-19-/t11-,13-,16-,21+/m0/s1 |
| InChIKey | GOKGOJNFBVNBJT-YTBIRXOZSA-N |
| XLogP | 2.51 |
| TPSA | 109.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |