About 2-[[4,5-dichloro-2-[(2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol
2-[[4,5-dichloro-2-[(2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol (PubChem CID 136859600) has the molecular formula C20H14Cl2N2O2
and a molecular weight of 385.25 g/mol. Its IUPAC name is 2-[[4,5-dichloro-2-[(2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol.
Molecular Properties
| Compound Name | 2-[[4,5-dichloro-2-[(2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol |
| PubChem CID | 136859600 |
| Molecular Formula | C20H14Cl2N2O2 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 2-[[4,5-dichloro-2-[(2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol |
| SMILES | Oc1ccccc1/C=N/c1cc(Cl)c(Cl)cc1/N=C/c1ccccc1O |
| InChI | InChI=1S/C20H14Cl2N2O2/c21-15-9-17(23-11-13-5-1-3-7-19(13)25)18(10-16(15)22)24-12-14-6-2-4-8-20(14)26/h1-12,25-26H/b23-11+,24-12+ |
| InChIKey | VDBBTYZYNJTICC-ASIDMNOUSA-N |
| XLogP | 5.91 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4,5-dichloro-2-[(2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4,5-dichloro-2-[(2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol?
The IUPAC name of 2-[[4,5-dichloro-2-[(2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol (CID 136859600) is 2-[[4,5-dichloro-2-[(2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol.
What is the SMILES notation for 2-[[4,5-dichloro-2-[(2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol?
The canonical SMILES for 2-[[4,5-dichloro-2-[(2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol is Oc1ccccc1/C=N/c1cc(Cl)c(Cl)cc1/N=C/c1ccccc1O.
What is the InChIKey of 2-[[4,5-dichloro-2-[(2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol?
The InChIKey is VDBBTYZYNJTICC-ASIDMNOUSA-N. The full InChI is InChI=1S/C20H14Cl2N2O2/c21-15-9-17(23-11-13-5-1-3-7-19(13)25)18(10-16(15)22)24-12-14-6-2-4-8-20(14)26/h1-12,25-26H/b23-11+,24-12+.
What are the key properties of 2-[[4,5-dichloro-2-[(2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol?
2-[[4,5-dichloro-2-[(2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol has a molecular weight of 385.25 g/mol, XLogP of 5.91, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4,5-dichloro-2-[(2-hydroxyphenyl)methylideneamino]phenyl]iminomethyl]phenol is sourced from PubChem (CID 136859600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).