C29H23N3O2 — CID 136862105
2-[[6-[(2-hydroxyphenyl)methylideneamino]-2,7-dimethylacridin-3-yl]iminomethyl]phenol (PubChem CID 136862105) has the molecular formula C29H23N3O2 and a molecular weight of 445.52 g/mol. Its IUPAC name is 2-[[6-[(2-hydroxyphenyl)methylideneamino]-2,7-dimethylacridin-3-yl]iminomethyl]phenol.
| Compound Name | 2-[[6-[(2-hydroxyphenyl)methylideneamino]-2,7-dimethylacridin-3-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 136862105 |
| Molecular Formula | C29H23N3O2 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 2-[[6-[(2-hydroxyphenyl)methylideneamino]-2,7-dimethylacridin-3-yl]iminomethyl]phenol |
| SMILES | Cc1cc2cc3cc(C)c(/N=C/c4ccccc4O)cc3nc2cc1/N=C/c1ccccc1O |
| InChI | InChI=1S/C29H23N3O2/c1-18-11-22-13-23-12-19(2)25(31-17-21-8-4-6-10-29(21)34)15-27(23)32-26(22)14-24(18)30-16-20-7-3-5-9-28(20)33/h3-17,33-34H,1-2H3/b30-16+,31-17+ |
| InChIKey | KPOJCATUXVJDDO-RVSCTIAXSA-N |
| XLogP | 6.92 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|