C20H21N7O2 — CID 136862318
6-amino-2-[(4-morpholin-4-ylphenyl)methylamino]-1,7-dihydroimidazo[4,5-g]quinazolin-8-one (PubChem CID 136862318) has the molecular formula C20H21N7O2 and a molecular weight of 391.44 g/mol. Its IUPAC name is 6-amino-2-[(4-morpholin-4-ylphenyl)methylamino]-1,7-dihydroimidazo[4,5-g]quinazolin-8-one.
| Compound Name | 6-amino-2-[(4-morpholin-4-ylphenyl)methylamino]-1,7-dihydroimidazo[4,5-g]quinazolin-8-one |
|---|---|
| PubChem CID | 136862318 |
| Molecular Formula | C20H21N7O2 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 6-amino-2-[(4-morpholin-4-ylphenyl)methylamino]-1,7-dihydroimidazo[4,5-g]quinazolin-8-one |
| SMILES | Nc1nc2cc3nc(NCc4ccc(N5CCOCC5)cc4)[nH]c3cc2c(=O)[nH]1 |
| InChI | InChI=1S/C20H21N7O2/c21-19-23-15-10-17-16(9-14(15)18(28)26-19)24-20(25-17)22-11-12-1-3-13(4-2-12)27-5-7-29-8-6-27/h1-4,9-10H,5-8,11H2,(H2,22,24,25)(H3,21,23,26,28) |
| InChIKey | OYYJPRKBPPJPCX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 124.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|