C22H15ClF3N7 — CID 136862555
2-[(5R,7S)-5-(4-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-[1,2,4]triazolo[1,5-c]quinazoline (PubChem CID 136862555) has the molecular formula C22H15ClF3N7 and a molecular weight of 469.86 g/mol. Its IUPAC name is 2-[(5R,7S)-5-(4-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-[1,2,4]triazolo[1,5-c]quinazoline.
| Compound Name | 2-[(5R,7S)-5-(4-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-[1,2,4]triazolo[1,5-c]quinazoline |
|---|---|
| PubChem CID | 136862555 |
| Molecular Formula | C22H15ClF3N7 |
| Molecular Weight | 469.86 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | 2-[(5R,7S)-5-(4-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-[1,2,4]triazolo[1,5-c]quinazoline |
| SMILES | FC(F)(F)[C@@H]1C[C@H](c2ccc(Cl)cc2)Nc2cc(-c3nc4c5ccccc5ncn4n3)nn21 |
| InChI | InChI=1S/C22H15ClF3N7/c23-13-7-5-12(6-8-13)16-9-18(22(24,25)26)33-19(28-16)10-17(30-33)20-29-21-14-3-1-2-4-15(14)27-11-32(21)31-20/h1-8,10-11,16,18,28H,9H2/t16-,18+/m1/s1 |
| InChIKey | HVCZNVWJFOGSFL-AEFFLSMTSA-N |
| XLogP | 5.45 |
| TPSA | 72.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.86 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |