C23H29Br2+ — CID 136864032
3-tert-butyl-6-[(2,6-dibromo-4-tert-butylcyclohexa-2,4-dien-1-ylidene)methylidene]-1,5-dimethylcyclohexa-1,3-diene (PubChem CID 136864032) has the molecular formula C23H29Br2+ and a molecular weight of 465.29 g/mol. Its IUPAC name is 3-tert-butyl-6-[(2,6-dibromo-4-tert-butylcyclohexa-2,4-dien-1-ylidene)methylidene]-1,5-dimethylcyclohexa-1,3-diene.
| Compound Name | 3-tert-butyl-6-[(2,6-dibromo-4-tert-butylcyclohexa-2,4-dien-1-ylidene)methylidene]-1,5-dimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 136864032 |
| Molecular Formula | C23H29Br2+ |
| Molecular Weight | 465.29 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | 3-tert-butyl-6-[(2,6-dibromo-4-tert-butylcyclohexa-2,4-dien-1-ylidene)methylidene]-1,5-dimethylcyclohexa-1,3-diene |
| SMILES | CC1=CC(C(C)(C)C)=C[C+](C)C1=C=C1C(Br)=CC(C(C)(C)C)=CC1Br |
| InChI | InChI=1S/C23H29Br2/c1-14-9-16(22(3,4)5)10-15(2)18(14)13-19-20(24)11-17(12-21(19)25)23(6,7)8/h9-12,20H,1-8H3/q+1 |
| InChIKey | YXJBAMZVYMNQJH-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.29 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|