C29H29N5O3S — CID 136865110
(7R)-N,7-bis(4-methoxyphenyl)-5-methyl-2-[(3-methylphenyl)methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 136865110) has the molecular formula C29H29N5O3S and a molecular weight of 527.65 g/mol. Its IUPAC name is (7R)-N,7-bis(4-methoxyphenyl)-5-methyl-2-[(3-methylphenyl)methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7R)-N,7-bis(4-methoxyphenyl)-5-methyl-2-[(3-methylphenyl)methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 136865110 |
| Molecular Formula | C29H29N5O3S |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | (7R)-N,7-bis(4-methoxyphenyl)-5-methyl-2-[(3-methylphenyl)methylsulfanyl]-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccc(NC(=O)C2=C(C)Nc3nc(SCc4cccc(C)c4)nn3[C@@H]2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H29N5O3S/c1-18-6-5-7-20(16-18)17-38-29-32-28-30-19(2)25(27(35)31-22-10-14-24(37-4)15-11-22)26(34(28)33-29)21-8-12-23(36-3)13-9-21/h5-16,26H,17H2,1-4H3,(H,31,35)(H,30,32,33)/t26-/m1/s1 |
| InChIKey | GZYBHOBVSFXJEU-AREMUKBSSA-N |
| XLogP | 5.82 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |