C15H21N3O3 — CID 136865961
2-(6-oxo-2-propan-2-yl-1H-pyrimidin-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid (PubChem CID 136865961) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-(6-oxo-2-propan-2-yl-1H-pyrimidin-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid.
| Compound Name | 2-(6-oxo-2-propan-2-yl-1H-pyrimidin-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 136865961 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 2-(6-oxo-2-propan-2-yl-1H-pyrimidin-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
| SMILES | CC(C)c1nc(N2CC3CCCC3C2C(=O)O)cc(=O)[nH]1 |
| InChI | InChI=1S/C15H21N3O3/c1-8(2)14-16-11(6-12(19)17-14)18-7-9-4-3-5-10(9)13(18)15(20)21/h6,8-10,13H,3-5,7H2,1-2H3,(H,20,21)(H,16,17,19) |
| InChIKey | QUHWVQRXVMKIOP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |