C10H18N4O2 — CID 136866826
5-amino-4-(6-hydroxyhexylamino)-1H-pyrimidin-6-one (PubChem CID 136866826) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 5-amino-4-(6-hydroxyhexylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-(6-hydroxyhexylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136866826 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 5-amino-4-(6-hydroxyhexylamino)-1H-pyrimidin-6-one |
| SMILES | Nc1c(NCCCCCCO)nc[nH]c1=O |
| InChI | InChI=1S/C10H18N4O2/c11-8-9(13-7-14-10(8)16)12-5-3-1-2-4-6-15/h7,15H,1-6,11H2,(H2,12,13,14,16) |
| InChIKey | WBSPWTLJWPHFHN-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|