About 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-methoxy-1H-pyrimidin-6-one
4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-methoxy-1H-pyrimidin-6-one (PubChem CID 136866837) has the molecular formula C9H15N3O5
and a molecular weight of 245.23 g/mol. Its IUPAC name is 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-methoxy-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-methoxy-1H-pyrimidin-6-one |
| PubChem CID | 136866837 |
| Molecular Formula | C9H15N3O5 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-methoxy-1H-pyrimidin-6-one |
| SMILES | COc1c(NC(CO)(CO)CO)nc[nH]c1=O |
| InChI | InChI=1S/C9H15N3O5/c1-17-6-7(10-5-11-8(6)16)12-9(2-13,3-14)4-15/h5,13-15H,2-4H2,1H3,(H2,10,11,12,16) |
| InChIKey | JJOWIDRNRLEQET-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 127.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-methoxy-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-methoxy-1H-pyrimidin-6-one?
The IUPAC name of 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-methoxy-1H-pyrimidin-6-one (CID 136866837) is 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-methoxy-1H-pyrimidin-6-one.
What is the SMILES notation for 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-methoxy-1H-pyrimidin-6-one?
The canonical SMILES for 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-methoxy-1H-pyrimidin-6-one is COc1c(NC(CO)(CO)CO)nc[nH]c1=O.
What is the InChIKey of 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-methoxy-1H-pyrimidin-6-one?
The InChIKey is JJOWIDRNRLEQET-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O5/c1-17-6-7(10-5-11-8(6)16)12-9(2-13,3-14)4-15/h5,13-15H,2-4H2,1H3,(H2,10,11,12,16).
What are the key properties of 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-methoxy-1H-pyrimidin-6-one?
4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-methoxy-1H-pyrimidin-6-one has a molecular weight of 245.23 g/mol, XLogP of -2.09, 6 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-methoxy-1H-pyrimidin-6-one is sourced from PubChem (CID 136866837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).