C17H17N3O — CID 136867577
3-[(2,4-dimethylphenyl)diazenyl]-7-methyl-1H-indol-2-ol (PubChem CID 136867577) has the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-[(2,4-dimethylphenyl)diazenyl]-7-methyl-1H-indol-2-ol.
| Compound Name | 3-[(2,4-dimethylphenyl)diazenyl]-7-methyl-1H-indol-2-ol |
|---|---|
| PubChem CID | 136867577 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 3-[(2,4-dimethylphenyl)diazenyl]-7-methyl-1H-indol-2-ol |
| SMILES | Cc1ccc(/N=N/c2c(O)[nH]c3c(C)cccc23)c(C)c1 |
| InChI | InChI=1S/C17H17N3O/c1-10-7-8-14(12(3)9-10)19-20-16-13-6-4-5-11(2)15(13)18-17(16)21/h4-9,18,21H,1-3H3/b20-19+ |
| InChIKey | WYCJXZKHTGDGJI-FMQUCBEESA-N |
| XLogP | 5.21 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|