About 3-[(2,4-dichlorophenyl)diazenyl]-5,7-difluoro-1H-indol-2-ol
3-[(2,4-dichlorophenyl)diazenyl]-5,7-difluoro-1H-indol-2-ol (PubChem CID 136867812) has the molecular formula C14H7Cl2F2N3O
and a molecular weight of 342.13 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)diazenyl]-5,7-difluoro-1H-indol-2-ol.
Molecular Properties
| Compound Name | 3-[(2,4-dichlorophenyl)diazenyl]-5,7-difluoro-1H-indol-2-ol |
| PubChem CID | 136867812 |
| Molecular Formula | C14H7Cl2F2N3O |
| Molecular Weight | 342.13 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)diazenyl]-5,7-difluoro-1H-indol-2-ol |
| SMILES | Oc1[nH]c2c(F)cc(F)cc2c1/N=N/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H7Cl2F2N3O/c15-6-1-2-11(9(16)3-6)20-21-13-8-4-7(17)5-10(18)12(8)19-14(13)22/h1-5,19,22H/b21-20+ |
| InChIKey | IZFXFKYQCZPSAI-QZQOTICOSA-N |
| XLogP | 5.87 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.13 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,4-dichlorophenyl)diazenyl]-5,7-difluoro-1H-indol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,4-dichlorophenyl)diazenyl]-5,7-difluoro-1H-indol-2-ol?
The IUPAC name of 3-[(2,4-dichlorophenyl)diazenyl]-5,7-difluoro-1H-indol-2-ol (CID 136867812) is 3-[(2,4-dichlorophenyl)diazenyl]-5,7-difluoro-1H-indol-2-ol.
What is the SMILES notation for 3-[(2,4-dichlorophenyl)diazenyl]-5,7-difluoro-1H-indol-2-ol?
The canonical SMILES for 3-[(2,4-dichlorophenyl)diazenyl]-5,7-difluoro-1H-indol-2-ol is Oc1[nH]c2c(F)cc(F)cc2c1/N=N/c1ccc(Cl)cc1Cl.
What is the InChIKey of 3-[(2,4-dichlorophenyl)diazenyl]-5,7-difluoro-1H-indol-2-ol?
The InChIKey is IZFXFKYQCZPSAI-QZQOTICOSA-N. The full InChI is InChI=1S/C14H7Cl2F2N3O/c15-6-1-2-11(9(16)3-6)20-21-13-8-4-7(17)5-10(18)12(8)19-14(13)22/h1-5,19,22H/b21-20+.
What are the key properties of 3-[(2,4-dichlorophenyl)diazenyl]-5,7-difluoro-1H-indol-2-ol?
3-[(2,4-dichlorophenyl)diazenyl]-5,7-difluoro-1H-indol-2-ol has a molecular weight of 342.13 g/mol, XLogP of 5.87, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,4-dichlorophenyl)diazenyl]-5,7-difluoro-1H-indol-2-ol is sourced from PubChem (CID 136867812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).