C14H15N5 — CID 136868009
(12R)-12-phenyl-1,7,9,11-tetrazatricyclo[6.4.0.02,6]dodeca-2(6),7,10-trien-10-amine (PubChem CID 136868009) has the molecular formula C14H15N5 and a molecular weight of 253.31 g/mol. Its IUPAC name is (12R)-12-phenyl-1,7,9,11-tetrazatricyclo[6.4.0.02,6]dodeca-2(6),7,10-trien-10-amine.
| Compound Name | (12R)-12-phenyl-1,7,9,11-tetrazatricyclo[6.4.0.02,6]dodeca-2(6),7,10-trien-10-amine |
|---|---|
| PubChem CID | 136868009 |
| Molecular Formula | C14H15N5 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | (12R)-12-phenyl-1,7,9,11-tetrazatricyclo[6.4.0.02,6]dodeca-2(6),7,10-trien-10-amine |
| SMILES | NC1=N[C@@H](c2ccccc2)n2c(nc3c2CCC3)N1 |
| InChI | InChI=1S/C14H15N5/c15-13-17-12(9-5-2-1-3-6-9)19-11-8-4-7-10(11)16-14(19)18-13/h1-3,5-6,12H,4,7-8H2,(H3,15,16,17,18)/t12-/m1/s1 |
| InChIKey | FNEORSLASDQVCQ-GFCCVEGCSA-N |
| XLogP | 1.66 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |