About 3-(3,4-dimethoxypyrrolidin-1-yl)-N'-hydroxypyrazine-2-carboximidamide
3-(3,4-dimethoxypyrrolidin-1-yl)-N'-hydroxypyrazine-2-carboximidamide (PubChem CID 136868262) has the molecular formula C11H17N5O3
and a molecular weight of 267.29 g/mol. Its IUPAC name is 3-(3,4-dimethoxypyrrolidin-1-yl)-N'-hydroxypyrazine-2-carboximidamide.
Molecular Properties
| Compound Name | 3-(3,4-dimethoxypyrrolidin-1-yl)-N'-hydroxypyrazine-2-carboximidamide |
| PubChem CID | 136868262 |
| Molecular Formula | C11H17N5O3 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 3-(3,4-dimethoxypyrrolidin-1-yl)-N'-hydroxypyrazine-2-carboximidamide |
| SMILES | COC1CN(c2nccnc2C(N)=NO)CC1OC |
| InChI | InChI=1S/C11H17N5O3/c1-18-7-5-16(6-8(7)19-2)11-9(10(12)15-17)13-3-4-14-11/h3-4,7-8,17H,5-6H2,1-2H3,(H2,12,15) |
| InChIKey | GMDZYWZDQCTXBW-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dimethoxypyrrolidin-1-yl)-N'-hydroxypyrazine-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethoxypyrrolidin-1-yl)-N'-hydroxypyrazine-2-carboximidamide?
The IUPAC name of 3-(3,4-dimethoxypyrrolidin-1-yl)-N'-hydroxypyrazine-2-carboximidamide (CID 136868262) is 3-(3,4-dimethoxypyrrolidin-1-yl)-N'-hydroxypyrazine-2-carboximidamide.
What is the SMILES notation for 3-(3,4-dimethoxypyrrolidin-1-yl)-N'-hydroxypyrazine-2-carboximidamide?
The canonical SMILES for 3-(3,4-dimethoxypyrrolidin-1-yl)-N'-hydroxypyrazine-2-carboximidamide is COC1CN(c2nccnc2C(N)=NO)CC1OC.
What is the InChIKey of 3-(3,4-dimethoxypyrrolidin-1-yl)-N'-hydroxypyrazine-2-carboximidamide?
The InChIKey is GMDZYWZDQCTXBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N5O3/c1-18-7-5-16(6-8(7)19-2)11-9(10(12)15-17)13-3-4-14-11/h3-4,7-8,17H,5-6H2,1-2H3,(H2,12,15).
What are the key properties of 3-(3,4-dimethoxypyrrolidin-1-yl)-N'-hydroxypyrazine-2-carboximidamide?
3-(3,4-dimethoxypyrrolidin-1-yl)-N'-hydroxypyrazine-2-carboximidamide has a molecular weight of 267.29 g/mol, XLogP of -0.58, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethoxypyrrolidin-1-yl)-N'-hydroxypyrazine-2-carboximidamide is sourced from PubChem (CID 136868262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).