C14H12N4OS2 — CID 136868471
(6-methyl-3-methylsulfanyl-4-sulfanylidene-7H-pyrazolo[5,4-d]pyrimidin-1-yl)-phenylmethanone (PubChem CID 136868471) has the molecular formula C14H12N4OS2 and a molecular weight of 316.41 g/mol. Its IUPAC name is (6-methyl-3-methylsulfanyl-4-sulfanylidene-7H-pyrazolo[5,4-d]pyrimidin-1-yl)-phenylmethanone.
| Compound Name | (6-methyl-3-methylsulfanyl-4-sulfanylidene-7H-pyrazolo[5,4-d]pyrimidin-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 136868471 |
| Molecular Formula | C14H12N4OS2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | (6-methyl-3-methylsulfanyl-4-sulfanylidene-7H-pyrazolo[5,4-d]pyrimidin-1-yl)-phenylmethanone |
| SMILES | CSc1nn(C(=O)c2ccccc2)c2[nH]c(C)nc(=S)c12 |
| InChI | InChI=1S/C14H12N4OS2/c1-8-15-11-10(12(20)16-8)13(21-2)17-18(11)14(19)9-6-4-3-5-7-9/h3-7H,1-2H3,(H,15,16,20) |
| InChIKey | YHLQSHDWBFTAQK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|