About CID 136870269
CID 136870269 (PubChem CID 136870269) has the molecular formula C13H27BClSi
and a molecular weight of 257.71 g/mol.
Molecular Properties
| Compound Name | CID 136870269 |
| PubChem CID | 136870269 |
| Molecular Formula | C13H27BClSi |
| Molecular Weight | 257.71 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | — |
| SMILES | CCCC/C(=C(\CC)B(CC)CC)[Si](C)Cl |
| InChI | InChI=1S/C13H27BClSi/c1-6-10-11-13(16(5)15)12(7-2)14(8-3)9-4/h6-11H2,1-5H3/b13-12- |
| InChIKey | HKNDGFXNDYRLBB-SEYXRHQNSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 257.71 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze CID 136870269 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136870269?
The IUPAC name of CID 136870269 (CID 136870269) is not available.
What is the SMILES notation for CID 136870269?
The canonical SMILES for CID 136870269 is CCCC/C(=C(\CC)B(CC)CC)[Si](C)Cl.
What is the InChIKey of CID 136870269?
The InChIKey is HKNDGFXNDYRLBB-SEYXRHQNSA-N. The full InChI is InChI=1S/C13H27BClSi/c1-6-10-11-13(16(5)15)12(7-2)14(8-3)9-4/h6-11H2,1-5H3/b13-12-.
What are the key properties of CID 136870269?
CID 136870269 has a molecular weight of 257.71 g/mol, XLogP of 5.36, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136870269 is sourced from PubChem (CID 136870269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).