About 2-ethyl-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-1H-pyrimidin-6-one
2-ethyl-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-1H-pyrimidin-6-one (PubChem CID 136870594) has the molecular formula C12H21N3O2
and a molecular weight of 239.32 g/mol. Its IUPAC name is 2-ethyl-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-ethyl-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-1H-pyrimidin-6-one |
| PubChem CID | 136870594 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 2-ethyl-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-1H-pyrimidin-6-one |
| SMILES | CCc1nc(NC(C)(C)C(C)(C)O)cc(=O)[nH]1 |
| InChI | InChI=1S/C12H21N3O2/c1-6-8-13-9(7-10(16)14-8)15-11(2,3)12(4,5)17/h7,17H,6H2,1-5H3,(H2,13,14,15,16) |
| InChIKey | UMQZQMQPOVKCCX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-1H-pyrimidin-6-one?
The IUPAC name of 2-ethyl-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-1H-pyrimidin-6-one (CID 136870594) is 2-ethyl-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-1H-pyrimidin-6-one.
What is the SMILES notation for 2-ethyl-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-1H-pyrimidin-6-one?
The canonical SMILES for 2-ethyl-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-1H-pyrimidin-6-one is CCc1nc(NC(C)(C)C(C)(C)O)cc(=O)[nH]1.
What is the InChIKey of 2-ethyl-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-1H-pyrimidin-6-one?
The InChIKey is UMQZQMQPOVKCCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O2/c1-6-8-13-9(7-10(16)14-8)15-11(2,3)12(4,5)17/h7,17H,6H2,1-5H3,(H2,13,14,15,16).
What are the key properties of 2-ethyl-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-1H-pyrimidin-6-one?
2-ethyl-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-1H-pyrimidin-6-one has a molecular weight of 239.32 g/mol, XLogP of 1.29, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-[(3-hydroxy-2,3-dimethylbutan-2-yl)amino]-1H-pyrimidin-6-one is sourced from PubChem (CID 136870594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).