About CID 136871061
CID 136871061 (PubChem CID 136871061) has the molecular formula C36H92Si10
and a molecular weight of 805.99 g/mol.
Molecular Properties
| Compound Name | CID 136871061 |
| PubChem CID | 136871061 |
| Molecular Formula | C36H92Si10 |
| Molecular Weight | 805.99 g/mol |
| Exact Mass | 804.49 |
| IUPAC Name | — |
| SMILES | CC(C)[Si](C(C)C)([Si]([Si](C)(C)C)[Si](C)(C)C)[Si](C(C)C)(C(C)C)[Si](C(C)C)(C(C)C)[Si](C(C)C)(C(C)C)[Si]([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C36H92Si10/c1-29(2)43(30(3)4,37(39(17,18)19)40(20,21)22)45(33(9)10,34(11)12)46(35(13)14,36(15)16)44(31(5)6,32(7)8)38(41(23,24)25)42(26,27)28/h29-36H,1-28H3 |
| InChIKey | GVIINOJYFKMJSP-UHFFFAOYSA-N |
| XLogP | 14.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 805.99 |
| LogP ≤ 5 | 14.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 136871061 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136871061?
The IUPAC name of CID 136871061 (CID 136871061) is not available.
What is the SMILES notation for CID 136871061?
The canonical SMILES for CID 136871061 is CC(C)[Si](C(C)C)([Si]([Si](C)(C)C)[Si](C)(C)C)[Si](C(C)C)(C(C)C)[Si](C(C)C)(C(C)C)[Si](C(C)C)(C(C)C)[Si]([Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of CID 136871061?
The InChIKey is GVIINOJYFKMJSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H92Si10/c1-29(2)43(30(3)4,37(39(17,18)19)40(20,21)22)45(33(9)10,34(11)12)46(35(13)14,36(15)16)44(31(5)6,32(7)8)38(41(23,24)25)42(26,27)28/h29-36H,1-28H3.
What are the key properties of CID 136871061?
CID 136871061 has a molecular weight of 805.99 g/mol, XLogP of 14.11, 17 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136871061 is sourced from PubChem (CID 136871061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).