C16H16ClN3O — CID 136872106
2-amino-4-(7-chloro-1-propylbenzimidazol-2-yl)phenol (PubChem CID 136872106) has the molecular formula C16H16ClN3O and a molecular weight of 301.78 g/mol. Its IUPAC name is 2-amino-4-(7-chloro-1-propylbenzimidazol-2-yl)phenol.
| Compound Name | 2-amino-4-(7-chloro-1-propylbenzimidazol-2-yl)phenol |
|---|---|
| PubChem CID | 136872106 |
| Molecular Formula | C16H16ClN3O |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-amino-4-(7-chloro-1-propylbenzimidazol-2-yl)phenol |
| SMILES | CCCn1c(-c2ccc(O)c(N)c2)nc2cccc(Cl)c21 |
| InChI | InChI=1S/C16H16ClN3O/c1-2-8-20-15-11(17)4-3-5-13(15)19-16(20)10-6-7-14(21)12(18)9-10/h3-7,9,21H,2,8,18H2,1H3 |
| InChIKey | YVBBKZYAVDJIBW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|