About 3-fluoro-4-[3-(1,3-thiazol-4-yl)-1,2,4-oxadiazol-5-yl]phenol
3-fluoro-4-[3-(1,3-thiazol-4-yl)-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 136872420) has the molecular formula C11H6FN3O2S
and a molecular weight of 263.25 g/mol. Its IUPAC name is 3-fluoro-4-[3-(1,3-thiazol-4-yl)-1,2,4-oxadiazol-5-yl]phenol.
Molecular Properties
| Compound Name | 3-fluoro-4-[3-(1,3-thiazol-4-yl)-1,2,4-oxadiazol-5-yl]phenol |
| PubChem CID | 136872420 |
| Molecular Formula | C11H6FN3O2S |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 3-fluoro-4-[3-(1,3-thiazol-4-yl)-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | Oc1ccc(-c2nc(-c3cscn3)no2)c(F)c1 |
| InChI | InChI=1S/C11H6FN3O2S/c12-8-3-6(16)1-2-7(8)11-14-10(15-17-11)9-4-18-5-13-9/h1-5,16H |
| InChIKey | AURMNBKRKDFMDN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-fluoro-4-[3-(1,3-thiazol-4-yl)-1,2,4-oxadiazol-5-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-[3-(1,3-thiazol-4-yl)-1,2,4-oxadiazol-5-yl]phenol?
The IUPAC name of 3-fluoro-4-[3-(1,3-thiazol-4-yl)-1,2,4-oxadiazol-5-yl]phenol (CID 136872420) is 3-fluoro-4-[3-(1,3-thiazol-4-yl)-1,2,4-oxadiazol-5-yl]phenol.
What is the SMILES notation for 3-fluoro-4-[3-(1,3-thiazol-4-yl)-1,2,4-oxadiazol-5-yl]phenol?
The canonical SMILES for 3-fluoro-4-[3-(1,3-thiazol-4-yl)-1,2,4-oxadiazol-5-yl]phenol is Oc1ccc(-c2nc(-c3cscn3)no2)c(F)c1.
What is the InChIKey of 3-fluoro-4-[3-(1,3-thiazol-4-yl)-1,2,4-oxadiazol-5-yl]phenol?
The InChIKey is AURMNBKRKDFMDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6FN3O2S/c12-8-3-6(16)1-2-7(8)11-14-10(15-17-11)9-4-18-5-13-9/h1-5,16H.
What are the key properties of 3-fluoro-4-[3-(1,3-thiazol-4-yl)-1,2,4-oxadiazol-5-yl]phenol?
3-fluoro-4-[3-(1,3-thiazol-4-yl)-1,2,4-oxadiazol-5-yl]phenol has a molecular weight of 263.25 g/mol, XLogP of 2.70, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-[3-(1,3-thiazol-4-yl)-1,2,4-oxadiazol-5-yl]phenol is sourced from PubChem (CID 136872420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).