C9H13ClN4O — CID 136873262
4-[(3R)-3-aminopiperidin-1-yl]-5-chloro-1H-pyrimidin-6-one (PubChem CID 136873262) has the molecular formula C9H13ClN4O and a molecular weight of 228.68 g/mol. Its IUPAC name is 4-[(3R)-3-aminopiperidin-1-yl]-5-chloro-1H-pyrimidin-6-one.
| Compound Name | 4-[(3R)-3-aminopiperidin-1-yl]-5-chloro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136873262 |
| Molecular Formula | C9H13ClN4O |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 4-[(3R)-3-aminopiperidin-1-yl]-5-chloro-1H-pyrimidin-6-one |
| SMILES | N[C@@H]1CCCN(c2nc[nH]c(=O)c2Cl)C1 |
| InChI | InChI=1S/C9H13ClN4O/c10-7-8(12-5-13-9(7)15)14-3-1-2-6(11)4-14/h5-6H,1-4,11H2,(H,12,13,15)/t6-/m1/s1 |
| InChIKey | BCSMOPGTOFYJON-ZCFIWIBFSA-N |
| XLogP | 0.35 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |