C13H15BrN4OS — CID 136873888
4-[(Z)-(3-bromo-4-hydroxyphenyl)methylideneamino]-3-butyl-1H-1,2,4-triazole-5-thione (PubChem CID 136873888) has the molecular formula C13H15BrN4OS and a molecular weight of 355.26 g/mol. Its IUPAC name is 4-[(Z)-(3-bromo-4-hydroxyphenyl)methylideneamino]-3-butyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(3-bromo-4-hydroxyphenyl)methylideneamino]-3-butyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 136873888 |
| Molecular Formula | C13H15BrN4OS |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 4-[(Z)-(3-bromo-4-hydroxyphenyl)methylideneamino]-3-butyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCCCc1n[nH]c(=S)n1/N=C\c1ccc(O)c(Br)c1 |
| InChI | InChI=1S/C13H15BrN4OS/c1-2-3-4-12-16-17-13(20)18(12)15-8-9-5-6-11(19)10(14)7-9/h5-8,19H,2-4H2,1H3,(H,17,20)/b15-8- |
| InChIKey | MPHYMQYCBMFQAZ-NVNXTCNLSA-N |
| XLogP | 3.63 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|