About 2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)sulfonylphenol
2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)sulfonylphenol (PubChem CID 1368742) has the molecular formula C12H6Cl4O4S
and a molecular weight of 388.06 g/mol. Its IUPAC name is 2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)sulfonylphenol.
Molecular Properties
| Compound Name | 2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)sulfonylphenol |
| PubChem CID | 1368742 |
| Molecular Formula | C12H6Cl4O4S |
| Molecular Weight | 388.06 g/mol |
| Exact Mass | 385.87 |
| IUPAC Name | 2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)sulfonylphenol |
| SMILES | O=S(=O)(c1cc(Cl)cc(Cl)c1O)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C12H6Cl4O4S/c13-5-1-7(15)11(17)9(3-5)21(19,20)10-4-6(14)2-8(16)12(10)18/h1-4,17-18H |
| InChIKey | UOGGDVSNMLEDIZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.06 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)sulfonylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)sulfonylphenol?
The IUPAC name of 2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)sulfonylphenol (CID 1368742) is 2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)sulfonylphenol.
What is the SMILES notation for 2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)sulfonylphenol?
The canonical SMILES for 2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)sulfonylphenol is O=S(=O)(c1cc(Cl)cc(Cl)c1O)c1cc(Cl)cc(Cl)c1O.
What is the InChIKey of 2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)sulfonylphenol?
The InChIKey is UOGGDVSNMLEDIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6Cl4O4S/c13-5-1-7(15)11(17)9(3-5)21(19,20)10-4-6(14)2-8(16)12(10)18/h1-4,17-18H.
What are the key properties of 2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)sulfonylphenol?
2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)sulfonylphenol has a molecular weight of 388.06 g/mol, XLogP of 4.54, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)sulfonylphenol is sourced from PubChem (CID 1368742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).