C19H25N3O5S — CID 136875074
ethyl (E)-3-hydroxy-4-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(4-methyl-1,3-thiazol-2-yl)but-2-enoate (PubChem CID 136875074) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is ethyl (E)-3-hydroxy-4-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(4-methyl-1,3-thiazol-2-yl)but-2-enoate.
| Compound Name | ethyl (E)-3-hydroxy-4-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(4-methyl-1,3-thiazol-2-yl)but-2-enoate |
|---|---|
| PubChem CID | 136875074 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | ethyl (E)-3-hydroxy-4-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(4-methyl-1,3-thiazol-2-yl)but-2-enoate |
| SMILES | CCOC(=O)/C(=C(\O)CN1C(=O)NC2(CCC(C)CC2)C1=O)c1nc(C)cs1 |
| InChI | InChI=1S/C19H25N3O5S/c1-4-27-16(24)14(15-20-12(3)10-28-15)13(23)9-22-17(25)19(21-18(22)26)7-5-11(2)6-8-19/h10-11,23H,4-9H2,1-3H3,(H,21,26)/b14-13- |
| InChIKey | HKPDIGHYDLRPQV-YPKPFQOOSA-N |
| XLogP | 2.78 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|