C17H21N5O5 — CID 136875313
2-[(6R)-2-methyl-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 136875313) has the molecular formula C17H21N5O5 and a molecular weight of 375.39 g/mol. Its IUPAC name is 2-[(6R)-2-methyl-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | 2-[(6R)-2-methyl-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 136875313 |
| Molecular Formula | C17H21N5O5 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 2-[(6R)-2-methyl-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-N-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(NC(=O)C[C@@H]2Cn3nc(C)nc3NC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C17H21N5O5/c1-9-18-17-20-16(24)10(8-22(17)21-9)5-14(23)19-11-6-12(25-2)15(27-4)13(7-11)26-3/h6-7,10H,5,8H2,1-4H3,(H,19,23)(H,18,20,21,24)/t10-/m1/s1 |
| InChIKey | RKRBEKJGQCWKIV-SNVBAGLBSA-N |
| XLogP | 1.21 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |