C64H74N8O4 — CID 136877066
N,N-dimethyl-3-[4-[10,15,20-tris[4-[3-(dimethylamino)propoxy]phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]propan-1-amine (PubChem CID 136877066) has the molecular formula C64H74N8O4 and a molecular weight of 1019.35 g/mol. Its IUPAC name is N,N-dimethyl-3-[4-[10,15,20-tris[4-[3-(dimethylamino)propoxy]phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]propan-1-amine.
| Compound Name | N,N-dimethyl-3-[4-[10,15,20-tris[4-[3-(dimethylamino)propoxy]phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 136877066 |
| Molecular Formula | C64H74N8O4 |
| Molecular Weight | 1019.35 g/mol |
| Exact Mass | 1018.58 |
| IUPAC Name | N,N-dimethyl-3-[4-[10,15,20-tris[4-[3-(dimethylamino)propoxy]phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]propan-1-amine |
| SMILES | CN(C)CCCOc1ccc(-c2c3nc(c(-c4ccc(OCCCN(C)C)cc4)c4ccc([nH]4)c(-c4ccc(OCCCN(C)C)cc4)c4nc(c(-c5ccc(OCCCN(C)C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C64H74N8O4/c1-69(2)37-9-41-73-49-21-13-45(14-22-49)61-53-29-31-55(65-53)62(46-15-23-50(24-16-46)74-42-10-38-70(3)4)57-33-35-59(67-57)64(48-19-27-52(28-20-48)76-44-12-40-72(7)8)60-36-34-58(68-60)63(56-32-30-54(61)66-56)47-17-25-51(26-18-47)75-43-11-39-71(5)6/h13-36,65,68H,9-12,37-44H2,1-8H3/b61-53-,61-54-,62-55-,62-57-,63-56-,63-58-,64-59-,64-60- |
| InChIKey | NDRTZLMKRQFZQT-WJVFOVLXSA-N |
| XLogP | 12.65 |
| TPSA | 107.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1019.35 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|