About 5-nitro-1H-1,2,4-triazole-3-carbonitrile
5-nitro-1H-1,2,4-triazole-3-carbonitrile (PubChem CID 136877101) has the molecular formula C3HN5O2
and a molecular weight of 139.07 g/mol. Its IUPAC name is 5-nitro-1H-1,2,4-triazole-3-carbonitrile.
Molecular Properties
| Compound Name | 5-nitro-1H-1,2,4-triazole-3-carbonitrile |
| PubChem CID | 136877101 |
| Molecular Formula | C3HN5O2 |
| Molecular Weight | 139.07 g/mol |
| Exact Mass | 139.01 |
| IUPAC Name | 5-nitro-1H-1,2,4-triazole-3-carbonitrile |
| SMILES | N#Cc1n[nH]c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C3HN5O2/c4-1-2-5-3(7-6-2)8(9)10/h(H,5,6,7) |
| InChIKey | DFMWFTKVMSSFLH-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 108.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.07 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-1H-1,2,4-triazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-1H-1,2,4-triazole-3-carbonitrile?
The IUPAC name of 5-nitro-1H-1,2,4-triazole-3-carbonitrile (CID 136877101) is 5-nitro-1H-1,2,4-triazole-3-carbonitrile.
What is the SMILES notation for 5-nitro-1H-1,2,4-triazole-3-carbonitrile?
The canonical SMILES for 5-nitro-1H-1,2,4-triazole-3-carbonitrile is N#Cc1n[nH]c([N+](=O)[O-])n1.
What is the InChIKey of 5-nitro-1H-1,2,4-triazole-3-carbonitrile?
The InChIKey is DFMWFTKVMSSFLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3HN5O2/c4-1-2-5-3(7-6-2)8(9)10/h(H,5,6,7).
What are the key properties of 5-nitro-1H-1,2,4-triazole-3-carbonitrile?
5-nitro-1H-1,2,4-triazole-3-carbonitrile has a molecular weight of 139.07 g/mol, XLogP of -0.42, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-1H-1,2,4-triazole-3-carbonitrile is sourced from PubChem (CID 136877101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).