About 5-(5-azido-1H-1,2,4-triazol-3-yl)-1-hydroxytetrazole
5-(5-azido-1H-1,2,4-triazol-3-yl)-1-hydroxytetrazole (PubChem CID 136877105) has the molecular formula C3H2N10O
and a molecular weight of 194.12 g/mol. Its IUPAC name is 5-(5-azido-1H-1,2,4-triazol-3-yl)-1-hydroxytetrazole.
Molecular Properties
| Compound Name | 5-(5-azido-1H-1,2,4-triazol-3-yl)-1-hydroxytetrazole |
| PubChem CID | 136877105 |
| Molecular Formula | C3H2N10O |
| Molecular Weight | 194.12 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 5-(5-azido-1H-1,2,4-triazol-3-yl)-1-hydroxytetrazole |
| SMILES | [N-]=[N+]=Nc1nc(-c2nnnn2O)n[nH]1 |
| InChI | InChI=1S/C3H2N10O/c4-10-9-3-5-1(6-8-3)2-7-11-12-13(2)14/h14H,(H,5,6,8) |
| InChIKey | MDADUSROCJALSH-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 154.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.12 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 5-(5-azido-1H-1,2,4-triazol-3-yl)-1-hydroxytetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-azido-1H-1,2,4-triazol-3-yl)-1-hydroxytetrazole?
The IUPAC name of 5-(5-azido-1H-1,2,4-triazol-3-yl)-1-hydroxytetrazole (CID 136877105) is 5-(5-azido-1H-1,2,4-triazol-3-yl)-1-hydroxytetrazole.
What is the SMILES notation for 5-(5-azido-1H-1,2,4-triazol-3-yl)-1-hydroxytetrazole?
The canonical SMILES for 5-(5-azido-1H-1,2,4-triazol-3-yl)-1-hydroxytetrazole is [N-]=[N+]=Nc1nc(-c2nnnn2O)n[nH]1.
What is the InChIKey of 5-(5-azido-1H-1,2,4-triazol-3-yl)-1-hydroxytetrazole?
The InChIKey is MDADUSROCJALSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2N10O/c4-10-9-3-5-1(6-8-3)2-7-11-12-13(2)14/h14H,(H,5,6,8).
What are the key properties of 5-(5-azido-1H-1,2,4-triazol-3-yl)-1-hydroxytetrazole?
5-(5-azido-1H-1,2,4-triazol-3-yl)-1-hydroxytetrazole has a molecular weight of 194.12 g/mol, XLogP of -0.36, 2 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-azido-1H-1,2,4-triazol-3-yl)-1-hydroxytetrazole is sourced from PubChem (CID 136877105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).