C22H17Cl2FN4OS — CID 136878386
(9R)-2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-9-(4-chlorophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 136878386) has the molecular formula C22H17Cl2FN4OS and a molecular weight of 475.38 g/mol. Its IUPAC name is (9R)-2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-9-(4-chlorophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (9R)-2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-9-(4-chlorophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 136878386 |
| Molecular Formula | C22H17Cl2FN4OS |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | (9R)-2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-9-(4-chlorophenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | O=C1CCCC2=C1[C@@H](c1ccc(Cl)cc1)n1nc(SCc3ccc(F)cc3Cl)nc1N2 |
| InChI | InChI=1S/C22H17Cl2FN4OS/c23-14-7-4-12(5-8-14)20-19-17(2-1-3-18(19)30)26-21-27-22(28-29(20)21)31-11-13-6-9-15(25)10-16(13)24/h4-10,20H,1-3,11H2,(H,26,27,28)/t20-/m1/s1 |
| InChIKey | KZPPATOINSGGKD-HXUWFJFHSA-N |
| XLogP | 6.04 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |