C19H23N5O3S — CID 136879749
5-[(3S)-3-[4-(dimethylamino)phenyl]-2-propanoyl-3,4-dihydropyrazol-5-yl]-6-hydroxy-1-methyl-2-sulfanylidenepyrimidin-4-one (PubChem CID 136879749) has the molecular formula C19H23N5O3S and a molecular weight of 401.49 g/mol. Its IUPAC name is 5-[(3S)-3-[4-(dimethylamino)phenyl]-2-propanoyl-3,4-dihydropyrazol-5-yl]-6-hydroxy-1-methyl-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-[(3S)-3-[4-(dimethylamino)phenyl]-2-propanoyl-3,4-dihydropyrazol-5-yl]-6-hydroxy-1-methyl-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 136879749 |
| Molecular Formula | C19H23N5O3S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 5-[(3S)-3-[4-(dimethylamino)phenyl]-2-propanoyl-3,4-dihydropyrazol-5-yl]-6-hydroxy-1-methyl-2-sulfanylidenepyrimidin-4-one |
| SMILES | CCC(=O)N1N=C(c2c(O)n(C)c(=S)[nH]c2=O)C[C@H]1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H23N5O3S/c1-5-15(25)24-14(11-6-8-12(9-7-11)22(2)3)10-13(21-24)16-17(26)20-19(28)23(4)18(16)27/h6-9,14,27H,5,10H2,1-4H3,(H,20,26,28)/t14-/m0/s1 |
| InChIKey | MUXZRIBKMSTMSI-AWEZNQCLSA-N |
| XLogP | 2.30 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|