C20H26N4O2S — CID 136879786
1-butyl-6-hydroxy-5-[(5R)-5-(4-propan-2-ylphenyl)-4,5-dihydro-1H-pyrazol-3-yl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 136879786) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is 1-butyl-6-hydroxy-5-[(5R)-5-(4-propan-2-ylphenyl)-4,5-dihydro-1H-pyrazol-3-yl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-butyl-6-hydroxy-5-[(5R)-5-(4-propan-2-ylphenyl)-4,5-dihydro-1H-pyrazol-3-yl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 136879786 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 1-butyl-6-hydroxy-5-[(5R)-5-(4-propan-2-ylphenyl)-4,5-dihydro-1H-pyrazol-3-yl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | CCCCn1c(O)c(C2=NN[C@@H](c3ccc(C(C)C)cc3)C2)c(=O)[nH]c1=S |
| InChI | InChI=1S/C20H26N4O2S/c1-4-5-10-24-19(26)17(18(25)21-20(24)27)16-11-15(22-23-16)14-8-6-13(7-9-14)12(2)3/h6-9,12,15,22,26H,4-5,10-11H2,1-3H3,(H,21,25,27)/t15-/m1/s1 |
| InChIKey | WCOWAGZDILCYPX-OAHLLOKOSA-N |
| XLogP | 3.97 |
| TPSA | 82.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|