About CID 136880009
CID 136880009 (PubChem CID 136880009) has the molecular formula C20H47N2Si6
and a molecular weight of 484.13 g/mol.
Molecular Properties
| Compound Name | CID 136880009 |
| PubChem CID | 136880009 |
| Molecular Formula | C20H47N2Si6 |
| Molecular Weight | 484.13 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | — |
| SMILES | C[Si](C)[Si](c1ccccc1)(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C20H47N2Si6/c1-23(2)28(20-18-16-15-17-19-20,21(24(3,4)5)25(6,7)8)22(26(9,10)11)27(12,13)14/h15-19H,1-14H3 |
| InChIKey | YNLQOCALRXDKIE-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.13 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 136880009 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136880009?
The IUPAC name of CID 136880009 (CID 136880009) is not available.
What is the SMILES notation for CID 136880009?
The canonical SMILES for CID 136880009 is C[Si](C)[Si](c1ccccc1)(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of CID 136880009?
The InChIKey is YNLQOCALRXDKIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H47N2Si6/c1-23(2)28(20-18-16-15-17-19-20,21(24(3,4)5)25(6,7)8)22(26(9,10)11)27(12,13)14/h15-19H,1-14H3.
What are the key properties of CID 136880009?
CID 136880009 has a molecular weight of 484.13 g/mol, XLogP of 6.11, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136880009 is sourced from PubChem (CID 136880009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).