C27H30N8O10 — CID 136880670
[(2R,3S,5R)-3-acetyloxy-5-[2-[(2,4-dioxo-1H-pyrimidin-5-yl)methylimino]-6-[2-(4-nitrophenyl)ethoxy]-3,6-dihydro-1H-purin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 136880670) has the molecular formula C27H30N8O10 and a molecular weight of 626.58 g/mol. Its IUPAC name is [(2R,3S,5R)-3-acetyloxy-5-[2-[(2,4-dioxo-1H-pyrimidin-5-yl)methylimino]-6-[2-(4-nitrophenyl)ethoxy]-3,6-dihydro-1H-purin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,5R)-3-acetyloxy-5-[2-[(2,4-dioxo-1H-pyrimidin-5-yl)methylimino]-6-[2-(4-nitrophenyl)ethoxy]-3,6-dihydro-1H-purin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 136880670 |
| Molecular Formula | C27H30N8O10 |
| Molecular Weight | 626.58 g/mol |
| Exact Mass | 626.21 |
| IUPAC Name | [(2R,3S,5R)-3-acetyloxy-5-[2-[(2,4-dioxo-1H-pyrimidin-5-yl)methylimino]-6-[2-(4-nitrophenyl)ethoxy]-3,6-dihydro-1H-purin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cnc3c2N/C(=N/Cc2c[nH]c(=O)[nH]c2=O)NC3OCCc2ccc([N+](=O)[O-])cc2)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H30N8O10/c1-14(36)43-12-20-19(44-15(2)37)9-21(45-20)34-13-30-22-23(34)31-26(28-10-17-11-29-27(39)32-24(17)38)33-25(22)42-8-7-16-3-5-18(6-4-16)35(40)41/h3-6,11,13,19-21,25H,7-10,12H2,1-2H3,(H2,28,31,33)(H2,29,32,38,39)/t19-,20+,21+,25?/m0/s1 |
| InChIKey | ASYWVRJXFHTLIM-FNGGWZMFSA-N |
| XLogP | 0.78 |
| TPSA | 234.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.58 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|