About 2-[1-(3,6-dihydro-2H-pyran-5-ylmethyl)piperidin-3-yl]-4-thiophen-2-yl-1H-pyrimidin-6-one
2-[1-(3,6-dihydro-2H-pyran-5-ylmethyl)piperidin-3-yl]-4-thiophen-2-yl-1H-pyrimidin-6-one (PubChem CID 136881503) has the molecular formula C19H23N3O2S
and a molecular weight of 357.48 g/mol. Its IUPAC name is 2-[1-(3,6-dihydro-2H-pyran-5-ylmethyl)piperidin-3-yl]-4-thiophen-2-yl-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-[1-(3,6-dihydro-2H-pyran-5-ylmethyl)piperidin-3-yl]-4-thiophen-2-yl-1H-pyrimidin-6-one |
| PubChem CID | 136881503 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 2-[1-(3,6-dihydro-2H-pyran-5-ylmethyl)piperidin-3-yl]-4-thiophen-2-yl-1H-pyrimidin-6-one |
| SMILES | O=c1cc(-c2cccs2)nc(C2CCCN(CC3=CCCOC3)C2)[nH]1 |
| InChI | InChI=1S/C19H23N3O2S/c23-18-10-16(17-6-3-9-25-17)20-19(21-18)15-5-1-7-22(12-15)11-14-4-2-8-24-13-14/h3-4,6,9-10,15H,1-2,5,7-8,11-13H2,(H,20,21,23) |
| InChIKey | RENDACYRXBFDMI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(3,6-dihydro-2H-pyran-5-ylmethyl)piperidin-3-yl]-4-thiophen-2-yl-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(3,6-dihydro-2H-pyran-5-ylmethyl)piperidin-3-yl]-4-thiophen-2-yl-1H-pyrimidin-6-one?
The IUPAC name of 2-[1-(3,6-dihydro-2H-pyran-5-ylmethyl)piperidin-3-yl]-4-thiophen-2-yl-1H-pyrimidin-6-one (CID 136881503) is 2-[1-(3,6-dihydro-2H-pyran-5-ylmethyl)piperidin-3-yl]-4-thiophen-2-yl-1H-pyrimidin-6-one.
What is the SMILES notation for 2-[1-(3,6-dihydro-2H-pyran-5-ylmethyl)piperidin-3-yl]-4-thiophen-2-yl-1H-pyrimidin-6-one?
The canonical SMILES for 2-[1-(3,6-dihydro-2H-pyran-5-ylmethyl)piperidin-3-yl]-4-thiophen-2-yl-1H-pyrimidin-6-one is O=c1cc(-c2cccs2)nc(C2CCCN(CC3=CCCOC3)C2)[nH]1.
What is the InChIKey of 2-[1-(3,6-dihydro-2H-pyran-5-ylmethyl)piperidin-3-yl]-4-thiophen-2-yl-1H-pyrimidin-6-one?
The InChIKey is RENDACYRXBFDMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O2S/c23-18-10-16(17-6-3-9-25-17)20-19(21-18)15-5-1-7-22(12-15)11-14-4-2-8-24-13-14/h3-4,6,9-10,15H,1-2,5,7-8,11-13H2,(H,20,21,23).
What are the key properties of 2-[1-(3,6-dihydro-2H-pyran-5-ylmethyl)piperidin-3-yl]-4-thiophen-2-yl-1H-pyrimidin-6-one?
2-[1-(3,6-dihydro-2H-pyran-5-ylmethyl)piperidin-3-yl]-4-thiophen-2-yl-1H-pyrimidin-6-one has a molecular weight of 357.48 g/mol, XLogP of 3.02, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(3,6-dihydro-2H-pyran-5-ylmethyl)piperidin-3-yl]-4-thiophen-2-yl-1H-pyrimidin-6-one is sourced from PubChem (CID 136881503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).