C16H17ClN4O2 — CID 136881846
2-[(2-chlorophenyl)methylamino]-4-(1-methyl-5-oxopyrrolidin-3-yl)-1H-pyrimidin-6-one (PubChem CID 136881846) has the molecular formula C16H17ClN4O2 and a molecular weight of 332.79 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylamino]-4-(1-methyl-5-oxopyrrolidin-3-yl)-1H-pyrimidin-6-one.
| Compound Name | 2-[(2-chlorophenyl)methylamino]-4-(1-methyl-5-oxopyrrolidin-3-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136881846 |
| Molecular Formula | C16H17ClN4O2 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 2-[(2-chlorophenyl)methylamino]-4-(1-methyl-5-oxopyrrolidin-3-yl)-1H-pyrimidin-6-one |
| SMILES | CN1CC(c2cc(=O)[nH]c(NCc3ccccc3Cl)n2)CC1=O |
| InChI | InChI=1S/C16H17ClN4O2/c1-21-9-11(6-15(21)23)13-7-14(22)20-16(19-13)18-8-10-4-2-3-5-12(10)17/h2-5,7,11H,6,8-9H2,1H3,(H2,18,19,20,22) |
| InChIKey | WCFHSJHQVQBCBG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |