C14H15FO4 — CID 136881965
(8S,9S)-9-deuterio-5-fluoro-8-(2-hydroxypropyl)-3,4,8,9-tetrahydrofuro[2,3-h]chromen-2-one (PubChem CID 136881965) has the molecular formula C14H15FO4 and a molecular weight of 267.27 g/mol. Its IUPAC name is (8S,9S)-9-deuterio-5-fluoro-8-(2-hydroxypropyl)-3,4,8,9-tetrahydrofuro[2,3-h]chromen-2-one.
| Compound Name | (8S,9S)-9-deuterio-5-fluoro-8-(2-hydroxypropyl)-3,4,8,9-tetrahydrofuro[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 136881965 |
| Molecular Formula | C14H15FO4 |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (8S,9S)-9-deuterio-5-fluoro-8-(2-hydroxypropyl)-3,4,8,9-tetrahydrofuro[2,3-h]chromen-2-one |
| SMILES | [2H][C@H]1c2c(cc(F)c3c2OC(=O)CC3)O[C@@H]1CC(C)O |
| InChI | InChI=1S/C14H15FO4/c1-7(16)4-8-5-10-12(18-8)6-11(15)9-2-3-13(17)19-14(9)10/h6-8,16H,2-5H2,1H3/t7?,8-/m1/s1/i5D/t5-,7?,8- |
| InChIKey | UMNULRVCWARMPE-VJTKCVNVSA-N |
| XLogP | 1.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|