C22H19N3O2 — CID 136882713
(2S)-3-[(Z)-1-(2-hydroxyphenyl)ethylideneamino]-2-phenyl-1,2-dihydroquinazolin-4-one (PubChem CID 136882713) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is (2S)-3-[(Z)-1-(2-hydroxyphenyl)ethylideneamino]-2-phenyl-1,2-dihydroquinazolin-4-one.
| Compound Name | (2S)-3-[(Z)-1-(2-hydroxyphenyl)ethylideneamino]-2-phenyl-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 136882713 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | (2S)-3-[(Z)-1-(2-hydroxyphenyl)ethylideneamino]-2-phenyl-1,2-dihydroquinazolin-4-one |
| SMILES | C/C(=N/N1C(=O)c2ccccc2N[C@@H]1c1ccccc1)c1ccccc1O |
| InChI | InChI=1S/C22H19N3O2/c1-15(17-11-6-8-14-20(17)26)24-25-21(16-9-3-2-4-10-16)23-19-13-7-5-12-18(19)22(25)27/h2-14,21,23,26H,1H3/b24-15-/t21-/m0/s1 |
| InChIKey | TXEVLGXTEJXXDR-UCHNXLLDSA-N |
| XLogP | 4.38 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|