C16H30N2S — CID 136883332
4-ethyl-4-methyl-N-(3,3,5,5-tetramethylcyclohexyl)-1,3-thiazolidin-2-imine (PubChem CID 136883332) has the molecular formula C16H30N2S and a molecular weight of 282.50 g/mol. Its IUPAC name is 4-ethyl-4-methyl-N-(3,3,5,5-tetramethylcyclohexyl)-1,3-thiazolidin-2-imine.
| Compound Name | 4-ethyl-4-methyl-N-(3,3,5,5-tetramethylcyclohexyl)-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 136883332 |
| Molecular Formula | C16H30N2S |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 4-ethyl-4-methyl-N-(3,3,5,5-tetramethylcyclohexyl)-1,3-thiazolidin-2-imine |
| SMILES | CCC1(C)CS/C(=N\C2CC(C)(C)CC(C)(C)C2)N1 |
| InChI | InChI=1S/C16H30N2S/c1-7-16(6)11-19-13(18-16)17-12-8-14(2,3)10-15(4,5)9-12/h12H,7-11H2,1-6H3,(H,17,18) |
| InChIKey | QHTDOWUSJBAMCJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|